Mc-1-f2
Modify Date: 2025-08-28 22:20:58
Mc-1-f2 structure
|
Common Name | Mc-1-f2 | ||
|---|---|---|---|---|
| CAS Number | 2376894-10-7 | Molecular Weight | 746.87 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H46N16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mc-1-f2MC-1-F2 is a FOXC2 inhibitor that reduces epithelial-mesenchymal transition (EMT) markers in breast cancer cells, suppresses cancer stem cell (CSC) properties and reduces invasiveness in castration-resistant prostate cancer (CRPC) cells. There is a synergistic effect between MC-1-F2 and Docetaxel, which has the potential to be used in combination to study CRPC[1]. |
| Name | MC-1-F2 |
|---|
| Description | MC-1-F2 is a FOXC2 inhibitor that reduces epithelial-mesenchymal transition (EMT) markers in breast cancer cells, suppresses cancer stem cell (CSC) properties and reduces invasiveness in castration-resistant prostate cancer (CRPC) cells. There is a synergistic effect between MC-1-F2 and Docetaxel, which has the potential to be used in combination to study CRPC[1]. |
|---|---|
| Related Catalog | |
| Target |
FOXC2[1]. |
| References |
| Molecular Formula | C37H46N16O2 |
|---|---|
| Molecular Weight | 746.87 |
| InChIKey | COSUURDQUHTOIY-UHFFFAOYSA-N |
| SMILES | NC(N)=NCCCCNc1nc(Nc2ccc(Oc3ccccc3)cc2)nc(N2CCN(c3nc(N)nc(Nc4ccc(N5CCOCC5)cc4)n3)CC2)n1 |