Benzene,1-(3-chlorophenoxy)-2,4-dinitro-
Modify Date: 2025-09-13 19:50:31
Benzene,1-(3-chlorophenoxy)-2,4-dinitro- structure
|
Common Name | Benzene,1-(3-chlorophenoxy)-2,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 2363-38-4 | Molecular Weight | 294.64700 | |
| Density | 1.505g/cm3 | Boiling Point | 390.3ºC at 760mmHg | |
| Molecular Formula | C12H7ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.8ºC | |
| Name | 3-chloro-2,4-dimethyl-quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.505g/cm3 |
|---|---|
| Boiling Point | 390.3ºC at 760mmHg |
| Molecular Formula | C12H7ClN2O5 |
| Molecular Weight | 294.64700 |
| Flash Point | 189.8ºC |
| Exact Mass | 294.00400 |
| PSA | 100.87000 |
| LogP | 4.99510 |
| Vapour Pressure | 6.02E-06mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | JPSNXDSHDVJVAB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc(Cl)c2)c([N+](=O)[O-])c1 |
|
~98%
Benzene,1-(3-ch... CAS#:2363-38-4 |
| Literature: Urgaonkar, Sameer; Verkade, John G. Organic Letters, 2005 , vol. 7, # 15 p. 3319 - 3322 |
|
~%
Benzene,1-(3-ch... CAS#:2363-38-4 |
| Literature: Reinheimer et al. Journal of Organic Chemistry, 1957 , vol. 22, p. 1743 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:119-27-7| 3-Chlor-2,4-dimethyl-chinolin |
| 1-(m-chlorophenoxy)-2,4-dinitrobenzene |
| 2,4-dimethyl-3-chloroquinoline |
| Quinoline,3-chloro-2,4-dimethyl |
| 2,4-Dinitrophenyl-3-chlorphenylether |
| (3-Chlor-phenyl)-(2,4-dinitro-phenyl)-aether |
| (3-chloro-phenyl)-(2,4-dinitro-phenyl)-ether |
| 3-chloro-2',4'-dinitro-diphenyl ether |
| 3'-Chlor-2.4-dinitro-diphenylaether |