Benzene,1-(2-chlorophenoxy)-2,4-dinitro- structure
|
Common Name | Benzene,1-(2-chlorophenoxy)-2,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 2363-37-3 | Molecular Weight | 294.64700 | |
| Density | 1.505g/cm3 | Boiling Point | 373.2ºC at 760mmHg | |
| Molecular Formula | C12H7ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.5ºC | |
| Name | 1-(2-chlorophenoxy)-2,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.505g/cm3 |
|---|---|
| Boiling Point | 373.2ºC at 760mmHg |
| Molecular Formula | C12H7ClN2O5 |
| Molecular Weight | 294.64700 |
| Flash Point | 179.5ºC |
| Exact Mass | 294.00400 |
| PSA | 100.87000 |
| LogP | 4.99510 |
| Vapour Pressure | 1.96E-05mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | DFCMFIKQNUYHQA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccccc2Cl)c([N+](=O)[O-])c1 |
|
~%
Benzene,1-(2-ch... CAS#:2363-37-3 |
| Literature: Bost; Nicholson Journal of the American Chemical Society, 1935 , vol. 57, p. 2368 |
|
~%
Benzene,1-(2-ch... CAS#:2363-37-3 |
| Literature: Reinheimer et al. Journal of Organic Chemistry, 1957 , vol. 22, p. 1743 |
| 2'-Chlor-2.4-dinitro-diphenylaether |
| 2-Chlor-2',4'-dinitro-diphenylether |