1-(Benzylideneamino)-1H-benzotriazole structure
|
Common Name | 1-(Benzylideneamino)-1H-benzotriazole | ||
|---|---|---|---|---|
| CAS Number | 23589-43-7 | Molecular Weight | 222.24500 | |
| Density | 1.22g/cm3 | Boiling Point | 402.4ºC at 760mmHg | |
| Molecular Formula | C13H10N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2ºC | |
| Name | N-(benzotriazol-1-yl)-1-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 402.4ºC at 760mmHg |
| Molecular Formula | C13H10N4 |
| Molecular Weight | 222.24500 |
| Flash Point | 197.2ºC |
| Exact Mass | 222.09100 |
| PSA | 43.07000 |
| LogP | 2.31350 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | KSFYLQMDWMTUSD-GXDHUFHOSA-N |
| SMILES | C(=Nn1nnc2ccccc21)c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~%
1-(Benzylidenea... CAS#:23589-43-7 |
| Literature: Dyablo; Mikhailus; Pozharskii; Trishkin Chemistry of Heterocyclic Compounds, 2005 , vol. 41, # 3 p. 329 - 339 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-benzylideneaminobenzotriazole |
| 1-Benzylideneamino-1,2,3-benzotriazole |
| benzotriazol-1-yl-benzylidene-amine |
| 1-Benzylideneamino-benzotriazol |