AM-Imidazole-PA-Boc
Modify Date: 2025-08-27 18:14:12
AM-Imidazole-PA-Boc structure
|
Common Name | AM-Imidazole-PA-Boc | ||
|---|---|---|---|---|
| CAS Number | 2357108-99-5 | Molecular Weight | 254.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AM-Imidazole-PA-BocAM-Imidazole-PA-Boc is a PROTAC linker, which refers to the alkyl chain composition. AM-Imidazole-PA-Boc can be used in the synthesis of a series of PROTAC IRAK4 degrader-1 (HY-129966)[1]. |
| Name | AM-Imidazole-PA-Boc |
|---|
| Description | AM-Imidazole-PA-Boc is a PROTAC linker, which refers to the alkyl chain composition. AM-Imidazole-PA-Boc can be used in the synthesis of a series of PROTAC IRAK4 degrader-1 (HY-129966)[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| References |
[1]. Nello Mainolfi, et al. Irak degraders and uses thereof. US20190192668A1. |
| Molecular Formula | C12H22N4O2 |
|---|---|
| Molecular Weight | 254.33 |
| InChIKey | BQENGFIYJNRYFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCn1cnc(CN)c1 |
| Hazard Codes | Xi |
|---|