TVD-0003510 structure
|
Common Name | TVD-0003510 | ||
|---|---|---|---|---|
| CAS Number | 2355276-51-4 | Molecular Weight | 464.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H32N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TVD-0003510TVD-0003510 is a carboxamide derivative, and involves in synthesis of (2-((6-(2-aminopyrimidine-5-carboxamido)-8-methoxy-3,4-dihydro-2H-pyrimido[1,2-c]quinazolin-9-yl)oxy)ethyl)piperazine-l-carboxylate (C51), as a part of tert-butyl2-(4-hydroxyphenyl)acetate[1]. |
| Name | TVD-0003510 |
|---|
| Description | TVD-0003510 is a carboxamide derivative, and involves in synthesis of (2-((6-(2-aminopyrimidine-5-carboxamido)-8-methoxy-3,4-dihydro-2H-pyrimido[1,2-c]quinazolin-9-yl)oxy)ethyl)piperazine-l-carboxylate (C51), as a part of tert-butyl2-(4-hydroxyphenyl)acetate[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H32N6O3 |
|---|---|
| Molecular Weight | 464.56 |
| InChIKey | SEJLSUIGJULNEN-UHFFFAOYSA-N |
| SMILES | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(CN2CCNCC2)cc1 |