Acetamide,2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)- structure
|
Common Name | Acetamide,2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 23543-12-6 | Molecular Weight | 264.10500 | |
| Density | 1.362g/cm3 | Boiling Point | 402.7ºC at 760mmHg | |
| Molecular Formula | C10H11Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.3ºC | |
| Name | 2-chloro-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 402.7ºC at 760mmHg |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.10500 |
| Flash Point | 197.3ºC |
| Exact Mass | 263.01200 |
| PSA | 47.56000 |
| LogP | 2.60750 |
| Vapour Pressure | 1.08E-06mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | ZNZPWAUYDVUDTN-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(NC(=O)CCl)cc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |