5'-O-DMTr-2'-O-methyl-N6-methyl adenosine 3'-CED phosphoramidite structure
|
Common Name | 5'-O-DMTr-2'-O-methyl-N6-methyl adenosine 3'-CED phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 2348385-04-4 | Molecular Weight | 797.88 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H52N7O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-O-DMTr-2'-O-methyl-N6-methyl adenosine 3'-CED phosphoramidite5'-O-DMTr-2'-O-methyl-N6-methyl adenosine 3'-CED phosphoramidite is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 5'-O-DMTr-2'-O-methyl-N6-methyl adenosine 3'-CED phosphoramidite |
|---|
| Description | 5'-O-DMTr-2'-O-methyl-N6-methyl adenosine 3'-CED phosphoramidite is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C42H52N7O7P |
|---|---|
| Molecular Weight | 797.88 |
| InChIKey | XXRTXDUOPCNYDH-DJADKNTFSA-N |
| SMILES | CNc1ncnc2c1ncn2C1OC(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C(OP(OCCC#N)N(C(C)C)C(C)C)C1OC |