5-(4-Chlorophenyl)oxazole-2-propionic acid structure
|
Common Name | 5-(4-Chlorophenyl)oxazole-2-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 23464-95-1 | Molecular Weight | 251.66600 | |
| Density | 1.348g/cm3 | Boiling Point | 437.5ºC at 760mmHg | |
| Molecular Formula | C12H10ClNO3 | Melting Point | 145-149ºC | |
| MSDS | Chinese USA | Flash Point | 218.4ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 437.5ºC at 760mmHg |
| Melting Point | 145-149ºC |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.66600 |
| Flash Point | 218.4ºC |
| Exact Mass | 251.03500 |
| PSA | 63.33000 |
| LogP | 3.01220 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | XKDNEJYXLSVRMO-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ncc(-c2ccc(Cl)cc2)o1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
|
~%
5-(4-Chlorophen... CAS#:23464-95-1 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 6, p. 707 - 712 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(5-(4-Chlorophenyl)oxazol-2-yl)propanoic acid |
| 5-(4-Chlorophenyl)oxazole-2-propionic acid |
| 3-[5-(4-chloro-phenyl)-oxazol-2-yl]-propionic acid |
| 2-Oxazolepropanoicacid,5-(4-chlorophenyl) |