Glycine,N-(3-chloro-4-fluorophenyl)-, ethyl ester structure
|
Common Name | Glycine,N-(3-chloro-4-fluorophenyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2344-98-1 | Molecular Weight | 231.65100 | |
| Density | 1.301g/cm3 | Boiling Point | 315.3ºC at 760mmHg | |
| Molecular Formula | C10H11ClFNO2 | Melting Point | 108-110ºC | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | Ethyl 2-(3-chloro-4-fluoroanilino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 315.3ºC at 760mmHg |
| Melting Point | 108-110ºC |
| Molecular Formula | C10H11ClFNO2 |
| Molecular Weight | 231.65100 |
| Flash Point | 144.5ºC |
| Exact Mass | 231.04600 |
| PSA | 38.33000 |
| LogP | 2.52710 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922499990 |
|
~%
Glycine,N-(3-ch... CAS#:2344-98-1 |
| Literature: Chemical Biology and Drug Design, , vol. 81, # 6 p. 715 - 729 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| N-<3-Chlor-4-fluor-phenyl>-glycin-aethylester |
| ethyl-2-(3-chloro-4-fluoroaniline)acetate |
| ethyl 2-[(3-chloro-4-fluorophenyl)amino]acetate |
| ethylchlorofluoroanilinoacetate |