2,6-DI(OXIRAN-2-YLMETHYL)-1,2,3,5,6,7-HEXAHYDROPYRROLO[3,4-F]ISOINDOLE-1,3,5,7-TETRAONE structure
|
Common Name | 2,6-DI(OXIRAN-2-YLMETHYL)-1,2,3,5,6,7-HEXAHYDROPYRROLO[3,4-F]ISOINDOLE-1,3,5,7-TETRAONE | ||
|---|---|---|---|---|
| CAS Number | 23328-66-7 | Molecular Weight | 328.27600 | |
| Density | 1.713 g/cm3 | Boiling Point | 570.4ºCat 760 mmHg | |
| Molecular Formula | C16H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.8ºC | |
| Name | 2,6-bis(oxiran-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.713 g/cm3 |
|---|---|
| Boiling Point | 570.4ºCat 760 mmHg |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.27600 |
| Flash Point | 298.8ºC |
| Exact Mass | 328.07000 |
| PSA | 103.20000 |
| Vapour Pressure | 5.04E-13mmHg at 25°C |
| Index of Refraction | 1.725 |
| InChIKey | DCFMPVOLRQDQHW-UHFFFAOYSA-N |
| SMILES | O=c1c2cc3c(=O)n(CC4CO4)c(=O)c3cc2c(=O)n1CC1CO1 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5,8,11,14,17,20-HEPTAOXAHENTRIACONTANE-31-THIO |
| 2,6-Di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetraone |
| benzene-1,2,4,5-tetracarboxylic acid 1,2:4,5-N,N'-diglycidyldiimide |