Acetamide,N-[2-(4-acetylphenyl)ethyl]- structure
|
Common Name | Acetamide,N-[2-(4-acetylphenyl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 23279-64-3 | Molecular Weight | 205.25300 | |
| Density | 1.064g/cm3 | Boiling Point | 428.9ºC at 760mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | N-[2-(4-acetyl-phenyl)-ethyl]-acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 428.9ºC at 760mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 182ºC |
| Exact Mass | 205.11000 |
| PSA | 46.17000 |
| LogP | 1.95870 |
| Vapour Pressure | 1.46E-07mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | MWPMMSVYHPAOIO-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCc1ccc(C(C)=O)cc1 |
|
~92%
Acetamide,N-[2-... CAS#:23279-64-3 |
| Literature: Day, Robert F.; Lafontaine, Jennifer A. Patent: US2002/52392 A1, 2002 ; US 20020052392 A1 |
|
~%
Acetamide,N-[2-... CAS#:23279-64-3 |
| Literature: Blicke; Lilienfeld Journal of the American Chemical Society, 1943 , vol. 65, p. 2377 |
| 4'-(2-Acetamidoethyl)-acetophenone |
| N-(4-acetyl-phenethyl)-acetamide |
| N-(4-Acetyl-phenaethyl)-acetamid |
| 1-[4-(2-Acetamino-aethyl)-phenyl]-aethanon-(1) |