(2-HYDROXY-5-METHOXY-PHENYL)-(1-PHENYL-1H-PYRAZOL-4-YL)-METHANONE structure
|
Common Name | (2-HYDROXY-5-METHOXY-PHENYL)-(1-PHENYL-1H-PYRAZOL-4-YL)-METHANONE | ||
|---|---|---|---|---|
| CAS Number | 23250-03-5 | Molecular Weight | 342.79900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20ClOP | Melting Point | 234-235ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (2-HYDROXY-5-METHOXY-PHENYL)-(1-PHENYL-1H-PYRAZOL-4-YL)-METHANONE |
| Name | 2-hydroxyethyl(triphenyl)phosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 234-235ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C20H20ClOP |
| Molecular Weight | 342.79900 |
| Exact Mass | 342.09400 |
| PSA | 33.82000 |
| InChIKey | NOEABYSOSUWXKG-UHFFFAOYSA-M |
| SMILES | OCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
|
~96%
(2-HYDROXY-5-ME... CAS#:23250-03-5 |
| Literature: Karatholuvhu, Maheswaran S.; Fuchs, Philip L. Journal of the American Chemical Society, 2004 , vol. 126, # 44 p. 14314 - 14315 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-hydroxy ethyltriphenylphosphonium chloride |
| MFCD00011754 |
| (2-Hydroxyethyl)triphenylphosphonium chloride |
| EINECS 245-521-6 |
| triphenyl-(2-hydroxy-ethyl)phosphonium chloride |
| Phosphonium,(2-hydroxyethyl)triphenyl-,chloride |
| 2-hydroxyethyl-1-triphenylphosphonium chloride |