2,2,2-trifluoroethyl trichloromethanesulfonate structure
|
Common Name | 2,2,2-trifluoroethyl trichloromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 23199-56-6 | Molecular Weight | 281.46500 | |
| Density | 1,714 g/cm3 | Boiling Point | 84-86°C 20mm | |
| Molecular Formula | C3H2Cl3F3O3S | Melting Point | -70°C | |
| MSDS | N/A | Flash Point | 84-86°C/20mm | |
Use of 2,2,2-trifluoroethyl trichloromethanesulfonate |
| Name | 2,2,2-trifluoroethyl trichloromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1,714 g/cm3 |
|---|---|
| Boiling Point | 84-86°C 20mm |
| Melting Point | -70°C |
| Molecular Formula | C3H2Cl3F3O3S |
| Molecular Weight | 281.46500 |
| Flash Point | 84-86°C/20mm |
| Exact Mass | 279.87400 |
| PSA | 51.75000 |
| LogP | 3.30360 |
| Index of Refraction | 1.4238 |
| InChIKey | GOIWZZQXWJVDOG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCC(F)(F)F)C(Cl)(Cl)Cl |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3265 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2905590090 |
|
~%
2,2,2-trifluoro... CAS#:23199-56-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 16, p. 1354 - 1360 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,2,2-Trifluoroethyl trichloromethanesulfonate |
| EINECS 245-484-6 |
| 2,2,2,-trifluoroethyl trichloromethane sulfonate |
| trichloro-methanesulfonic acid 2,2,2-trifluoro-ethyl ester |
| 2,2,2-trifluoroethyl trichloromethanosulfonate |
| MFCD00042400 |
| 2,2,2-Trifluoroethyl trichloromethanesulphonate |