2,4-Imidazolidinedione,5-methyl-5-(4-methylphenyl)-
Modify Date: 2025-08-26 11:33:58
2,4-Imidazolidinedione,5-methyl-5-(4-methylphenyl)- structure
|
Common Name | 2,4-Imidazolidinedione,5-methyl-5-(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 23186-96-1 | Molecular Weight | 204.22500 | |
| Density | 1.182g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-Dioxo-4-methyl-4-propyl-imidazolidin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.22500 |
| Exact Mass | 204.09000 |
| PSA | 58.20000 |
| LogP | 1.70720 |
| Index of Refraction | 1.546 |
| InChIKey | RTMDEHNRMKFSML-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2(C)NC(=O)NC2=O)cc1 |
| HS Code | 2933990090 |
|---|
|
~90%
2,4-Imidazolidi... CAS#:23186-96-1 |
| Literature: Ndzie; Cardinael; Schoofs; Coquerel Tetrahedron Asymmetry, 1997 , vol. 8, # 17 p. 2913 - 2920 |
|
~%
2,4-Imidazolidi... CAS#:23186-96-1 |
| Literature: Henze; Speer Journal of the American Chemical Society, 1942 , vol. 64, p. 522 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
| 5-Methyl-5-propyl-imidazolidin-2,4-dion |
| 5-methyl-5-propylhydantoin |
| 5-Methyl-5-p-tolyl-imidazolidin-2,4-dion |
| 5-methyl-5-p-tolyl-imidazolidine-2,4-dione |
| 5-(4-methylphenyl)-5-methylhydantoin |
| 5-Methyl-5-(p-tolyl)-hydantoin |
| 5-methyl-5-propyl-imidazolidine-2,4-dione |