5-nitro-6-methylquinoline structure
|
Common Name | 5-nitro-6-methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 23141-61-9 | Molecular Weight | 188.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 330.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | 117ºC | |
| MSDS | Chinese USA | Flash Point | 153.7±23.7 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
Use of 5-nitro-6-methylquinoline |
| Name | 6-methyl-5-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.5±27.0 °C at 760 mmHg |
| Melting Point | 117ºC |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.183 |
| Flash Point | 153.7±23.7 °C |
| Exact Mass | 188.058578 |
| PSA | 58.71000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | CENBTULRDDPOGR-UHFFFAOYSA-N |
| SMILES | Cc1ccc2ncccc2c1[N+](=O)[O-] |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R36/37/38;R40 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2933499090 |
|
~%
5-nitro-6-methy... CAS#:23141-61-9 |
| Literature: Journal of the American Chemical Society, , vol. 34, p. 1574 |
|
~2%
5-nitro-6-methy... CAS#:23141-61-9 |
| Literature: Achmatowicz, Michal; Thiel, Oliver R.; Gorins, Gilles; Goldstein, Corinne; Affouard, Caroline; Jensen, Randy; Larsen, Robert D. Journal of Organic Chemistry, 2008 , vol. 73, # 17 p. 6793 - 6799 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
J. Am. Chem. Soc. 34 , 1574, (1912)
|
| EINECS 245-447-4 |
| 6-Methyl-5-nitroquinoline |
| MFCD00024021 |
| 6-methyl-5-nitro-quinoline |
| Quinoline, 6-methyl-5-nitro- |
| 5-nitro-6-methylquinoline |
| 6-Methyl-5-nitrochinolin |