3-(N,N-Diacetoxyethyl)amino-4-methoxyacetanilide
Modify Date: 2025-08-25 09:42:58
3-(N,N-Diacetoxyethyl)amino-4-methoxyacetanilide structure
|
Common Name | 3-(N,N-Diacetoxyethyl)amino-4-methoxyacetanilide | ||
|---|---|---|---|---|
| CAS Number | 23128-51-0 | Molecular Weight | 352.38200 | |
| Density | 1.212 g/cm3 | Boiling Point | 526.8ºC at 760 mmHg | |
| Molecular Formula | C17H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.4ºC | |
| Name | 3-(N,N-Diacetoxyethyl)amino-4-methoxyacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212 g/cm3 |
|---|---|
| Boiling Point | 526.8ºC at 760 mmHg |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.38200 |
| Flash Point | 272.4ºC |
| Exact Mass | 352.16300 |
| PSA | 94.17000 |
| LogP | 1.65920 |
| Vapour Pressure | 3.46E-11mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | AEQXCNSBJJHGGE-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(C)=O)cc1N(CCOC(C)=O)CCOC(C)=O |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:108-45-2
CAS#:24530-67-4![2,2'-[[5-acetamido-4-[(2-bromo-4,6-dinitrophenyl)azo]-2-methoxyphenyl]imino]diethyl diacetate structure](https://image.chemsrc.com/caspic/491/3618-72-2.png)
CAS#:3618-72-2| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-N,N-bis- |
| MFCD00035811 |
| 3-DIACETOXYETHYLAMINO-4-METHOXY ACETANILIDE |
| Einecs 245-441-1 |