1-amino-4-[(4-methoxyphenyl)amino]anthraquinone
Modify Date: 2025-11-21 10:00:12
![1-amino-4-[(4-methoxyphenyl)amino]anthraquinone Structure](https://image.chemsrc.com/caspic/243/23060-42-6.png)
1-amino-4-[(4-methoxyphenyl)amino]anthraquinone structure
|
Common Name | 1-amino-4-[(4-methoxyphenyl)amino]anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 23060-42-6 | Molecular Weight | 344.36300 | |
| Density | 1.369g/cm3 | Boiling Point | 582.9ºC at 760mmHg | |
| Molecular Formula | C21H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.3ºC | |
| Name | 1-amino-4-(4-methoxyanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 582.9ºC at 760mmHg |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.36300 |
| Flash Point | 306.3ºC |
| Exact Mass | 344.11600 |
| PSA | 81.42000 |
| LogP | 4.45060 |
| Vapour Pressure | 1.42E-13mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | MMFCPKYGMSQKCQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2922509090 |
|---|
|
~89%
1-amino-4-[(4-m... CAS#:23060-42-6 |
| Literature: Philip, George; Nabar, U. T.; Kanetkar, V. R.; Sunthankar, S. V. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 8 p. 808 - 811 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Amino-4-((4-methoxyphenyl)amino)anthraquinone |
| 9,10-Anthracenedione,1-amino-4-((4-methoxyphenyl)amino) |
| 1-amino-4-p-anisidino-anthraquinone |
| EINECS 245-405-5 |
| 1-Amino-4-p-anisidino-anthrachinon |