1-amino-4-[[4-[(dimethylamino)methyl]phenyl]amino]anthraquinone, compound with acetic acid (1:1) structure
|
Common Name | 1-amino-4-[[4-[(dimethylamino)methyl]phenyl]amino]anthraquinone, compound with acetic acid (1:1) | ||
|---|---|---|---|---|
| CAS Number | 83968-83-6 | Molecular Weight | 431.48400 | |
| Density | N/A | Boiling Point | 659.6ºC at 760 mmHg | |
| Molecular Formula | C25H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.7ºC | |
| Name | acetic acid,1-amino-4-[4-[(dimethylamino)methyl]anilino]anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 659.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.48400 |
| Flash Point | 352.7ºC |
| Exact Mass | 431.18500 |
| PSA | 112.73000 |
| LogP | 4.59450 |
| InChIKey | PXGXWZHUDOZTOK-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CN(C)Cc1ccc(Nc2ccc(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| einecs 281-563-1 |