N6-(3-Trifluoromethylbenzyl)-2’-C-methyl adenosine structure
|
Common Name | N6-(3-Trifluoromethylbenzyl)-2’-C-methyl adenosine | ||
|---|---|---|---|---|
| CAS Number | 2305415-78-3 | Molecular Weight | 439.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20F3N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N6-(3-Trifluoromethylbenzyl)-2’-C-methyl adenosineN6-(3-Trifluoromethylbenzyl)-2’-C-methyl adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | N6-(3-Trifluoromethylbenzyl)-2’-C-methyl adenosine |
|---|
| Description | N6-(3-Trifluoromethylbenzyl)-2’-C-methyl adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H20F3N5O4 |
|---|---|
| Molecular Weight | 439.39 |
| InChIKey | XASOSWGKKYFVTP-AXYPVASZSA-N |
| SMILES | CC1(O)C(O)C(CO)OC1n1cnc2c(NCc3cccc(C(F)(F)F)c3)ncnc21 |