2,3-dihydro-6-methyl-2-thioxopyrimidin-4(1H)-one, monosodium salt structure
|
Common Name | 2,3-dihydro-6-methyl-2-thioxopyrimidin-4(1H)-one, monosodium salt | ||
|---|---|---|---|---|
| CAS Number | 22874-42-6 | Molecular Weight | 164.16100 | |
| Density | N/A | Boiling Point | 275.5ºC at 760mmHg | |
| Molecular Formula | C5H5N2NaOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.4ºC | |
| Name | sodium,6-methyl-2-sulfanylidene-1H-pyrimidin-3-id-4-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 275.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C5H5N2NaOS |
| Molecular Weight | 164.16100 |
| Flash Point | 120.4ºC |
| Exact Mass | 164.00200 |
| PSA | 87.64000 |
| LogP | 1.21750 |
| Vapour Pressure | 0.000637mmHg at 25°C |
| InChIKey | KOXSMEKMHFMILE-UHFFFAOYSA-M |
| SMILES | Cc1cc(=O)[n-]c(=S)[nH]1.[Na+] |
|
~97%
2,3-dihydro-6-m... CAS#:22874-42-6 |
| Literature: Rakhimov; Titova; Fedunov; Babkin Chemistry of Heterocyclic Compounds, 2008 , vol. 44, # 6 p. 700 - 708 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| sodium salt of 4-methyl-2-thiouracil |
| Sodium methylthiouracil |
| Uracil,6-methyl-2-thio-,monosodium salt |
| EINECS 245-278-6 |