(R)-BDP9066
Modify Date: 2025-10-15 10:50:53
(R)-BDP9066 structure
|
Common Name | (R)-BDP9066 | ||
|---|---|---|---|---|
| CAS Number | 2284549-25-1 | Molecular Weight | 348.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (R)-BDP9066(R)-BDP9066 is a potent inhibitor of myotonic dystrophy kinase-related Cdc42-binding kinase (MRCK). (R)-BDP9066 blocks cancer cell invasion. (R)-BDP9066 has the potential for the research of proliferative diseases, such as cancer. |
| Name | (R)-BDP9066 |
|---|
| Description | (R)-BDP9066 is a potent inhibitor of myotonic dystrophy kinase-related Cdc42-binding kinase (MRCK). (R)-BDP9066 blocks cancer cell invasion. (R)-BDP9066 has the potential for the research of proliferative diseases, such as cancer. |
|---|---|
| Related Catalog | |
| References |
[1]. Pyrrolo[2,3-b]pyridine compounds and their use in the treatment of cancer. Patent WO2019034890A1. |
| Molecular Formula | C20H24N6 |
|---|---|
| Molecular Weight | 348.44 |
| InChIKey | UELSMLDRSQFVHG-HXUWFJFHSA-N |
| SMILES | c1cc(-c2c[nH]c3nccc(N4CCCC5(CCCCN5)C4)c23)ncn1 |
| Storage condition | 2-8°C |