sodium,2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate structure
|
Common Name | sodium,2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate | ||
|---|---|---|---|---|
| CAS Number | 2264-25-7 | Molecular Weight | 368.05200 | |
| Density | N/A | Boiling Point | 188.1ºC at 760 mmHg | |
| Molecular Formula | C7HF12NaO2 | Melting Point | 250ºC (dec.) | |
| MSDS | N/A | Flash Point | 67.6ºC | |
| Name | sodium,2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 188.1ºC at 760 mmHg |
|---|---|
| Melting Point | 250ºC (dec.) |
| Molecular Formula | C7HF12NaO2 |
| Molecular Weight | 368.05200 |
| Flash Point | 67.6ºC |
| Exact Mass | 367.96800 |
| PSA | 40.13000 |
| LogP | 2.17790 |
| Vapour Pressure | 0.272mmHg at 25°C |
| InChIKey | SZWOFFNEMGRGMA-UHFFFAOYSA-M |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.[Na+] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2915900090 |
|
~95%
sodium,2,2,3,3,... CAS#:2264-25-7 |
| Literature: Yoshino, Norio; Komine, Noboru; Suzuki, Jun-ichi; Arima, Yuki; Hirai, Hidefumi Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 11 p. 3262 - 3266 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| sodium 2,2,3,3,4,4,5,5,6,6,7,7-dodecakis(fluoranyl)heptanoate |
| Sodium 7H-perfluoroheptanoate |
| sodium 7H-dodecafluoroheptanoate |
| 7H-dodecafluoro-heptanoic acid,sodium salt |
| PC0633 |
| Sodium 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate |