benzyl-hexyl-dimethylazanium,chloride structure
|
Common Name | benzyl-hexyl-dimethylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 22559-57-5 | Molecular Weight | 255.82700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl-hexyl-dimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H26ClN |
|---|---|
| Molecular Weight | 255.82700 |
| Exact Mass | 255.17500 |
| LogP | 0.84730 |
| InChIKey | BNDXNEVHWSOJGV-UHFFFAOYSA-M |
| SMILES | CCCCCC[N+](C)(C)Cc1ccccc1.[Cl-] |
| Hazard Codes | C: Corrosive;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R21/22 |
| Safety Phrases | 26-36/37/39-45-61 |
| RIDADR | UN 2923 8/PG 3 |
| HS Code | 2923900090 |
|
~%
benzyl-hexyl-di... CAS#:22559-57-5 |
| Literature: Stepanenko,B.N. et al. Pharmaceutical Chemistry Journal, 1974 , vol. 8, # 10 p. 602 - 604 Khimiko-Farmatsevticheskii Zhurnal, 1974 , vol. 8, # 10 p. 21 - 24 |
|
~%
benzyl-hexyl-di... CAS#:22559-57-5 |
| Literature: Stepanenko,B.N. et al. Pharmaceutical Chemistry Journal, 1974 , vol. 8, # 10 p. 602 - 604 Khimiko-Farmatsevticheskii Zhurnal, 1974 , vol. 8, # 10 p. 21 - 24 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenemethanaminium,N-hexyl-N,N-dimethyl-,chloride (1:1) |
| Ammonium,benzylhexyldimethyl-,chloride (8CI) |
| Benzylhexyldimethylammonium chloride |
| Benzenemethanaminium,N-hexyl-N,N-dimethyl-,chloride (9CI) |
| UNII-I010P10X5B |
| Benzylhexyldimethylammonium chloride(7CI) |
| BENZYLDIMETHYLHEXYLAMMONIUM CHLORIDE |