Fmoc-Tyr(3-F,tBu)-OH
Modify Date: 2025-08-25 11:38:40
Fmoc-Tyr(3-F,tBu)-OH structure
|
Common Name | Fmoc-Tyr(3-F,tBu)-OH | ||
|---|---|---|---|---|
| CAS Number | 2254698-84-3 | Molecular Weight | 477.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H28FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Tyr(3-F,tBu)-OHFmoc-Tyr(3-F,tBu)-OH is a cyclic peptide compound with high membrane permeability and can specifically binds to a target molecule (extracted from patent WO2018225864A1)[1]. |
| Name | Fmoc-Tyr(3-F,tBu)-OH |
|---|
| Description | Fmoc-Tyr(3-F,tBu)-OH is a cyclic peptide compound with high membrane permeability and can specifically binds to a target molecule (extracted from patent WO2018225864A1)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H28FNO5 |
|---|---|
| Molecular Weight | 477.52 |
| InChIKey | ZLZOTVKOIDTAHM-DEOSSOPVSA-N |
| SMILES | CC(C)(C)Oc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1F |