N-carbethoxyphthalimide structure
|
Common Name | N-carbethoxyphthalimide | ||
|---|---|---|---|---|
| CAS Number | 22509-74-6 | Molecular Weight | 219.193 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 353.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H9NO4 | Melting Point | 90-92 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 167.8±23.2 °C | |
| Name | ethyl 1,3-dioxoisoindole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 353.9±25.0 °C at 760 mmHg |
| Melting Point | 90-92 °C(lit.) |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.193 |
| Flash Point | 167.8±23.2 °C |
| Exact Mass | 219.053162 |
| PSA | 63.68000 |
| LogP | 1.15 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | VRHAQNTWKSVEEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C(=O)c2ccccc2C1=O |
| Storage condition | 0-6°C |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S22-S24/25-S36/37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | NR3459500 |
| HS Code | 29251995 |
|
~93%
N-carbethoxypht... CAS#:22509-74-6 |
| Literature: Worster, Paul M.; Leznoff, Clifford C.; McArthur, Colin R. Journal of Organic Chemistry, 1980 , vol. 45, # 1 p. 174 - 175 |
|
~98%
N-carbethoxypht... CAS#:22509-74-6 |
| Literature: Soai, Kenso; Ookawa, Atsuhiro; Kato, Kyoko Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 5 p. 1671 - 1672 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Tetrahedron 49 , 13, (1993)
|
| 2H-Isoindole-2-carboxylic acid, 1,3-dihydro-1,3-dioxo-, ethyl ester |
| 1,3-Dihydro-1,3-dioxo-2H-isoindole-2-carboxylic acid,ethyl ester |
| Ethyl N-phthaloylcarbamate |
| Ethyl 1,3-dioxo-2-isoindolinecarboxylate |
| Ethyl 1,3-dioxo-1,3-dihydro-2H-isoindole-2-carboxylate |
| EINECS 245-048-5 |
| N-Carbethoxyphthalimide |
| 2-Isoindolinecarboxylic acid,1,3-dioxo-,ethyl ester |
| T56 BVNVJ CVO2 |
| Phthalimide-N-carbethoxy |
| MFCD00005893 |
| N-carbethoxy-phthalimide |
| Ethyl phthalimide-N-carboxylate |
| N-Carboethoxyphthalimide |
| N-Ethoxycarbonylphthalimide |
| 2H-Isoindole-2-carboxylic acid,1,3-dihydro-1,3-dioxo-,ethyl ester |
| 1,3-Dioxo-1,3-dihydro-isoindole-2-c; arboxylic acid ethyl ester |
| Nefkin's reagent |
| 1,3-Dioxo-1,3-dihydro-isoindole-2-carboxylic acid ethyl ester |