Clozic structure
|
Common Name | Clozic | ||
|---|---|---|---|---|
| CAS Number | 22494-47-9 | Molecular Weight | 304.76800 | |
| Density | 1.218g/cm3 | Boiling Point | 472ºC at 760mmHg | |
| Molecular Formula | C17H17ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
Use of ClozicClozic is a potential anti-arthritic agent. |
| Name | 2-[[4-(4-chlorophenyl)phenyl]methoxy]-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Clozic is a potential anti-arthritic agent. |
|---|---|
| Related Catalog | |
| In Vitro | Clozic is a potential anti-arthritic agent. Concentrations of Clozic greater than 50 μM cause a dose-dependent decrease in the amount of matrix protein synthesized by RHMC cell cultures. Inhibition of RHMC cell culture growth by Clozic occurs in a dose-dependent manner. The anti-proliferative effect of Clozic on RHMC cell growth is reversible. Lactate dehydrogenase (LDH) levels in media taken from RHMC cell cultures exposed to 500 μM Clozic for 3 days do not significantly differ from LDH levels in control cell culture media[1]. |
| Cell Assay | Approximately 3×104 to 5×104 cells/mL medium are seeded into 24-well plates and incubated at 37°C in a humidified atmosphere of 95% air/5% CO2. Medium is replaced with fresh medium containing 20% foetal calf serum and methanol or Clozic under investigation. Cell numbers are determined in replicate wells on various days during culture growth[1]. |
| References |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760mmHg |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.76800 |
| Flash Point | 239.2ºC |
| Exact Mass | 304.08700 |
| PSA | 46.53000 |
| LogP | 4.38680 |
| Vapour Pressure | 1.03E-09mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | UGOFYAXVVVXMQT-UHFFFAOYSA-N |
| SMILES | CC(C)(OCc1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| Storage condition | 2-8℃ |
| HS Code | 2918990090 |
|---|
|
~43%
Clozic CAS#:22494-47-9 |
| Literature: Imperial Chemical Industries Limited Patent: US4348322 A1, 1982 ; |
|
~50%
Detail
|
| Literature: Imperial Chemical Industries Limited Patent: US4348322 A1, 1982 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Clobuzaritum [INN-Latin] |
| Clobuzarit |
| EINECS 245-035-4 |
| 2-[[p-(p-chlorophenyl)benzyl]oxy]-2-methylpropionic acid |
| 2-((4'-Chloro-4-biphenylyl)methoxy)-2-methylpropionic acid |
| Clobuzaritum |
| 2-{[(4'-chlorobiphenyl-4-yl)methyl]oxy}-2-methylpropanoic acid |
| Propanoic acid,2-((4'-chloro(1,1'-biphenyl)-4-yl)methoxy)-2-methyl |
| 2-[4-(4-chlorophenyl)benzyloxy]-2-methylpropionic acid |
| Clozic |