11h-perfluoroundecanoyl chloride
Modify Date: 2025-08-23 16:21:26
11h-perfluoroundecanoyl chloride structure
|
Common Name | 11h-perfluoroundecanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2248-93-3 | Molecular Weight | 564.54600 | |
| Density | 1.719g/cm3 | Boiling Point | 209.3ºC at 760mmHg | |
| Molecular Formula | C11HClF20O | Melting Point | 54-56°C | |
| MSDS | N/A | Flash Point | 80.4ºC | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.719g/cm3 |
|---|---|
| Boiling Point | 209.3ºC at 760mmHg |
| Melting Point | 54-56°C |
| Molecular Formula | C11HClF20O |
| Molecular Weight | 564.54600 |
| Flash Point | 80.4ºC |
| Exact Mass | 563.94000 |
| PSA | 17.07000 |
| LogP | 6.73460 |
| InChIKey | LFSNWCISDMSHBB-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3261 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2915900090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:22116-95-6
CAS#:90441-62-6| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 11H-F-undecanoyl chloride |
| 11H-Perfluoroundecanoyl chloride |
| 11h-eicosafluoroundecanoyl chloride |
| Eicosafluor-11H-undecansaeurechlorid |
| MFCD00042119 |
| 11H-Eicosafluoro-1-undecanoylchloride |
| PC3796 |