n-boc-3-hydroxy-1,2,3,6-tetrahydropyridine
n-boc-3-hydroxy-1,2,3,6-tetrahydropyridine structure
|
Common Name | n-boc-3-hydroxy-1,2,3,6-tetrahydropyridine | ||
|---|---|---|---|---|
| CAS Number | 224779-27-5 | Molecular Weight | 199.24700 | |
| Density | 1.138g/cm3 | Boiling Point | 295.9ºC at 760mmHg | |
| Molecular Formula | C10H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.8ºC | |
| Name | tert-butyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 295.9ºC at 760mmHg |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.24700 |
| Flash Point | 132.8ºC |
| Exact Mass | 199.12100 |
| PSA | 49.77000 |
| LogP | 1.09210 |
| Appearance of Characters | Light-Yellow Solid |
| Vapour Pressure | 0.000153mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | NICJOYHYEDFTIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=CC(O)C1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
|
~98%
n-boc-3-hydroxy... CAS#:224779-27-5 |
| Literature: Takahata, Hiroki; Suto, Yumiko; Kato, Erina; Yoshimura, Yuichi; Ouchi, Hidekazu Advanced Synthesis and Catalysis, 2007 , vol. 349, # 4-5 p. 685 - 693 |
|
~%
n-boc-3-hydroxy... CAS#:224779-27-5 |
| Literature: Synlett, , # 5 p. 741 - 744 |
|
~%
n-boc-3-hydroxy... CAS#:224779-27-5 |
| Literature: Advanced Synthesis and Catalysis, , vol. 349, # 4-5 p. 685 - 693 |
|
~%
n-boc-3-hydroxy... CAS#:224779-27-5 |
| Literature: WO2013/138210 A1, ; |
|
~%
n-boc-3-hydroxy... CAS#:224779-27-5 |
| Literature: WO2013/138210 A1, ; |
|
~%
n-boc-3-hydroxy... CAS#:224779-27-5 |
| Literature: WO2013/138210 A1, ; |
|
~%
n-boc-3-hydroxy... CAS#:224779-27-5 |
| Literature: WO2013/138210 A1, ; |
![tert-Butyl 7-oxa-3-aza-bicyclo[4.1.0]heptane-3-carboxylate structure](https://image.chemsrc.com/caspic/258/161157-50-2.png)
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester |
| N-BOC-3-HYDROXY-1,2,3,6-TETRAHYDROPYRIDINE |
| tert-butyl 3-hydroxy-1,2,3,6-tetrahydropyridinecarboxylate |
| tert-butyl 3-hydroxy-1,2,3,6-tetrahydropyridine-N-carboxylate |
| 1-Boc-3-hydroxy-1,2,3,6-tetrahydro-pyridine |