3-[[1-Methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]-1-propanol structure
|
Common Name | 3-[[1-Methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]-1-propanol | ||
|---|---|---|---|---|
| CAS Number | 22444-69-5 | Molecular Weight | 261.28300 | |
| Density | 1.143g/cm3 | Boiling Point | 325.1ºC at 760mmHg | |
| Molecular Formula | C13H18F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.4ºC | |
| Name | 3-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]propan-1-ol |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 325.1ºC at 760mmHg |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.28300 |
| Flash Point | 150.4ºC |
| Exact Mass | 261.13400 |
| PSA | 32.26000 |
| LogP | 2.99930 |
| Vapour Pressure | 9.59E-05mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | XFUOIIGOAIUWRS-UHFFFAOYSA-N |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)NCCCO |
| HS Code | 2922199090 |
|---|
|
~%
3-[[1-Methyl-2-... CAS#:22444-69-5 |
| Literature: Science Union et Cie. Patent: FR1517587 , 1968 ; Chem.Abstr., 1969 , vol. 70, # 106229 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |