1H-Benzimidazole,2-(4-morpholinyl)-1-b-D-ribofuranosyl-
Modify Date: 2025-10-12 23:12:22
1H-Benzimidazole,2-(4-morpholinyl)-1-b-D-ribofuranosyl- structure
|
Common Name | 1H-Benzimidazole,2-(4-morpholinyl)-1-b-D-ribofuranosyl- | ||
|---|---|---|---|---|
| CAS Number | 22416-78-0 | Molecular Weight | 335.35500 | |
| Density | 1.61g/cm3 | Boiling Point | 638.3ºC at 760mmHg | |
| Molecular Formula | C16H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.8ºC | |
| Name | diphenylarsanylmethyl(diphenyl)arsane |
|---|
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 638.3ºC at 760mmHg |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.35500 |
| Flash Point | 339.8ºC |
| Exact Mass | 335.14800 |
| PSA | 100.21000 |
| Vapour Pressure | 3.64E-17mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | WVZZEQRFPCAVED-UHFFFAOYSA-N |
| SMILES | OCC1OC(n2c(N3CCOCC3)nc3ccccc32)C(O)C1O |
|
~%
1H-Benzimidazol... CAS#:22416-78-0 |
| Literature: Revankar,G.R.; Townsend,L.B. Journal of Heterocyclic Chemistry, 1968 , vol. 5, p. 477 - 483 |
|
~%
1H-Benzimidazol... CAS#:22416-78-0 |
| Literature: Revankar,G.R.; Townsend,L.B. Journal of Heterocyclic Chemistry, 1968 , vol. 5, p. 477 - 483 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |