(R)-4-METHYL-5,5-DIPHENYLOXAZOLIDIN-2-ONE structure
|
Common Name | (R)-4-METHYL-5,5-DIPHENYLOXAZOLIDIN-2-ONE | ||
|---|---|---|---|---|
| CAS Number | 223906-37-4 | Molecular Weight | 253.29600 | |
| Density | 1.156 g/cm3 | Boiling Point | 465ºC at 760 mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | 268-272ºC(lit.) | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | (4R)-4-methyl-5,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156 g/cm3 |
|---|---|
| Boiling Point | 465ºC at 760 mmHg |
| Melting Point | 268-272ºC(lit.) |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 235ºC |
| Exact Mass | 253.11000 |
| PSA | 38.33000 |
| LogP | 3.38730 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | URUDVMKJOXKZHR-GFCCVEGCSA-N |
| SMILES | CC1NC(=O)OC1(c1ccccc1)c1ccccc1 |
|
~73%
(R)-4-METHYL-5,... CAS#:223906-37-4 |
| Literature: Bull, Steven D.; Davies, Stephen G.; Jones, Simon; Sanganee, Hitesh J. Journal of the Chemical Society - Perkin Transactions 1, 1999 , # 4 p. 387 - 398 |
| MFCD03093549 |