[2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3,4,5,6-tetrafluorophenyl]-bis(2,3,4,5,6-pentafluorophenyl)borane structure
|
Common Name | [2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3,4,5,6-tetrafluorophenyl]-bis(2,3,4,5,6-pentafluorophenyl)borane | ||
|---|---|---|---|---|
| CAS Number | 223769-13-9 | Molecular Weight | 837.90500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30B2F24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3,4,5,6-tetrafluorophenyl]-bis(2,3,4,5,6-pentafluorophenyl)borane |
|---|
| Molecular Formula | C30B2F24 |
|---|---|
| Molecular Weight | 837.90500 |
| Exact Mass | 837.98000 |
| LogP | 6.05740 |
| InChIKey | IBLWLIPJHDGLJN-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
|
~55%
[2-bis(2,3,4,5,... CAS#:223769-13-9 |
| Literature: Williams, V. Clifford; Piers, Warren E.; Clegg, William; Elsegood, Mark R.J.; Collins, Scott; Mardell, Todd B. Journal of the American Chemical Society, 1999 , vol. 121, # 13 p. 3244 - 3245 |