4,4'-Bis(4-chlorophenyl)sulfonyl-1,1'-biphenyl structure
|
Common Name | 4,4'-Bis(4-chlorophenyl)sulfonyl-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 22287-56-5 | Molecular Weight | 503.41700 | |
| Density | 1.416g/cm3 | Boiling Point | 685ºC at 760 mmHg | |
| Molecular Formula | C24H16Cl2O4S2 | Melting Point | 278-280 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 368.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-chlorophenyl)sulfonyl-4-[4-(4-chlorophenyl)sulfonylphenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 685ºC at 760 mmHg |
| Melting Point | 278-280 °C(lit.) |
| Molecular Formula | C24H16Cl2O4S2 |
| Molecular Weight | 503.41700 |
| Flash Point | 368.1ºC |
| Exact Mass | 501.98700 |
| PSA | 85.04000 |
| LogP | 8.48760 |
| Vapour Pressure | 7.68E-18mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | OZUNPRDEUXITBO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1ccc(-c2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4'-bis((4-chlorophenyl)sulfonyl)-1,1'-biphenyl |
| MFCD00184229 |