Daclatasvir Impurity B
Modify Date: 2025-09-21 17:55:04
Daclatasvir Impurity B structure
|
Common Name | Daclatasvir Impurity B | ||
|---|---|---|---|---|
| CAS Number | 2226541-13-3 | Molecular Weight | 623.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H41N7O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Daclatasvir Impurity BDaclatasvir Impurity B is the impurity of Daclatasvir. Daclatasvir is a potent HCV NS5A protein inhibitor[1]. |
| Name | Daclatasvir Impurity B |
|---|
| Description | Daclatasvir Impurity B is the impurity of Daclatasvir. Daclatasvir is a potent HCV NS5A protein inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C35H41N7O4 |
|---|---|
| Molecular Weight | 623.74 |
| InChIKey | JYVHPJBIMHHKQX-RWSKJCERSA-N |
| SMILES | COC(=O)NC(C(=O)N1CCCC1c1ncc(-c2ccc(-c3ccc(-c4cnc(C5CCCN5C(C)=O)[nH]4)cc3)cc2)[nH]1)C(C)C |