4-Hydroxy-N,N-diethyltryptamine structure
|
Common Name | 4-Hydroxy-N,N-diethyltryptamine | ||
|---|---|---|---|---|
| CAS Number | 22204-89-3 | Molecular Weight | 232.321 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 413.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.1±25.9 °C | |
Use of 4-Hydroxy-N,N-diethyltryptamine4-hydroxy DET is a substituted tryptamine which is structurally related to the natural hallucinogen psilocin (4-hydroxy dimethyltryptamine). |
| Name | 4-Hydroxy-N,N-diethyltryptamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 413.9±35.0 °C at 760 mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.321 |
| Flash Point | 204.1±25.9 °C |
| Exact Mass | 232.157562 |
| PSA | 39.26000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | OHHYMKDBKJPILO-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCc1c[nH]c2cccc(O)c12 |
| HS Code | 2933990090 |
|---|
|
~%
4-Hydroxy-N,N-d... CAS#:22204-89-3 |
| Literature: Helvetica Chimica Acta, , vol. 42, p. 2073,2098 |
|
~%
4-Hydroxy-N,N-d... CAS#:22204-89-3 |
| Literature: Helvetica Chimica Acta, , vol. 42, p. 2073,2098 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-[2-(Diethylamino)ethyl]-1H-indol-4-ol |
| 4-Hydroxy-N,N-Diethyltryptamine(4-HO-DET) |
| 1H-Indol-4-ol, 3-[2-(diethylamino)ethyl]- |