4-Hydroxy-N,N-diisopropyltryptamine
Modify Date: 2025-08-20 11:30:27
4-Hydroxy-N,N-diisopropyltryptamine structure
|
Common Name | 4-Hydroxy-N,N-diisopropyltryptamine | ||
|---|---|---|---|---|
| CAS Number | 132328-45-1 | Molecular Weight | 260.37500 | |
| Density | 1.084g/cm3 | Boiling Point | 424.911ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.779ºC | |
| Name | 3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 424.911ºC at 760 mmHg |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.37500 |
| Flash Point | 210.779ºC |
| Exact Mass | 260.18900 |
| PSA | 39.26000 |
| LogP | 3.53480 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | KBRYKXCBGISXQV-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCc1c[nH]c2cccc(O)c12)C(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-diisopropylamino-ethyl)-indol-4-ol |
| MFCD04972059 |
| 1H-Indol-4-ol,3-[2-[bis(1-methylethyl)amino]ethyl] |
| 4-Hydroxy-N,N-diisopropyltryptamine |
| N,N-Diisopropyl-4-hydroxytryptamine |