LYN-1604 hydrochloride structure
|
Common Name | LYN-1604 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2216753-86-3 | Molecular Weight | 621.080 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H44Cl3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LYN-1604 hydrochlorideLYN-1604 is a novel activator of ULK1, inducing cell death involved in ATF3, RAD21, and caspase3, accompanied by autophagy and apoptosis. LYN-1604 could induce cell death, associated with autophagy by the ULK complex (ULK1-mATG13-FIP200-ATG101) in MDA-MB-231 cells. To further explore LYN-1604-induced autophagic mechanisms, we found some potential ULK1 interactors, such as ATF3, RAD21, and caspase3, by performing comparative microarray analysis. LYN-1604 induced cell death involved in ATF3, RAD21, and caspase3, accompanied by autophagy and apoptosis. |
| Name | 1-{4-[2-(2,4-Dichlorophenyl)-2-(2-naphthylmethoxy)ethyl]-1-piperazinyl}-2-(diisobutylamino)ethanone hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H44Cl3N3O2 |
|---|---|
| Molecular Weight | 621.080 |
| Exact Mass | 619.249939 |
| InChIKey | KWFDUNOLEJSFBQ-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(=O)N1CCN(CC(OCc2ccc3ccccc3c2)c2ccc(Cl)cc2Cl)CC1)CC(C)C.Cl |
| Hazard Codes | Xn |
|---|
| Ethanone, 2-[bis(2-methylpropyl)amino]-1-[4-[2-(2,4-dichlorophenyl)-2-(2-naphthalenylmethoxy)ethyl]-1-piperazinyl]-, hydrochloride (1:1) |
| 1-{4-[2-(2,4-Dichlorophenyl)-2-(2-naphthylmethoxy)ethyl]-1-piperazinyl}-2-(diisobutylamino)ethanone hydrochloride (1:1) |
| MFCD31630830 |