Amino(4-biphenylyl)acetic acid
Modify Date: 2025-08-21 05:48:03
Amino(4-biphenylyl)acetic acid structure
|
Common Name | Amino(4-biphenylyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 221101-61-7 | Molecular Weight | 227.258 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 414.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.5±27.3 °C | |
| Name | 2-amino-2-(4-phenylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.5±40.0 °C at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.258 |
| Flash Point | 204.5±27.3 °C |
| Exact Mass | 227.094635 |
| PSA | 63.32000 |
| LogP | 2.70 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | BMWOGALGPJNHSP-UHFFFAOYSA-N |
| SMILES | NC(C(=O)O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| a-Amino-biphenyl-4-acetic acid |
| AMINO-BIPHENYL-4-YL-ACETIC ACID |
| Amino(4-biphenylyl)acetic acid |
| [1,1'-Biphenyl]-4-acetic acid, α-amino- |