1H-Pyrrole-3-carbonyl chloride, 1-phenyl- (9CI) structure
|
Common Name | 1H-Pyrrole-3-carbonyl chloride, 1-phenyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 220968-56-9 | Molecular Weight | 205.64000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenylpyrrole-3-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8ClNO |
|---|---|
| Molecular Weight | 205.64000 |
| Exact Mass | 205.02900 |
| PSA | 22.00000 |
| LogP | 2.85630 |
| InChIKey | SNVBAYLNSBVPPN-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccn(-c2ccccc2)c1 |
|
~%
1H-Pyrrole-3-ca... CAS#:220968-56-9 |
| Literature: Fabis, Frederic; Dallemagne, Patrick; Rault, Sylvain; Robba, Max Organic Preparations and Procedures International, 1995 , vol. 27, # 2 p. 236 - 239 |
|
~%
1H-Pyrrole-3-ca... CAS#:220968-56-9 |
| Literature: Fabis, Frederic; Dallemagne, Patrick; Rault, Sylvain; Robba, Max Organic Preparations and Procedures International, 1995 , vol. 27, # 2 p. 236 - 239 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-PHENYL-1H-PYRROLE-3-CARBONYL CHLORIDE |
| 1H-Pyrrole-3-carbonylchloride,1-phenyl |