3-(trifluoromethoxy)benzenesulfonyl chloride structure
|
Common Name | 3-(trifluoromethoxy)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 220227-84-9 | Molecular Weight | 260.61800 | |
| Density | 1.530 g/mL at 25 °C(lit.) | Boiling Point | 229-230 °C(lit.) | |
| Molecular Formula | C7H4ClF3O3S | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | >230 °F | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-(trifluoromethoxy)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.530 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 229-230 °C(lit.) |
| Molecular Formula | C7H4ClF3O3S |
| Molecular Weight | 260.61800 |
| Flash Point | >230 °F |
| Exact Mass | 259.95200 |
| PSA | 51.75000 |
| LogP | 3.59350 |
| Vapour Pressure | 0.0187mmHg at 25°C |
| Index of Refraction | n20/D 1.4760(lit.) |
| InChIKey | DODDSXTWDSJCDN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc(OC(F)(F)F)c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45-S39-S37-S36 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2909309090 |
|
~%
3-(trifluoromet... CAS#:220227-84-9 |
| Literature: Journal of the American Chemical Society, , vol. 135, # 29 p. 10638 - 10641 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-trifluoromethoxyphenylsulfonyl chloride |
| MFCD01091016 |
| 3-(Trifluoromethoxy)benzenesulfonyl chloride |
| 3-trifluoromethoxylbenzene-1-sulfonyl chloride |
| 3-(Trifluoromethoxy)benzene-1-sulfonyl chloride |