Littorine
Modify Date: 2025-08-25 22:34:28
Littorine structure
|
Common Name | Littorine | ||
|---|---|---|---|---|
| CAS Number | 21956-47-8 | Molecular Weight | 289.36900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LittorineLittorine is a alkaloid that can be isolated from Anthocercis fittorea and Datura species[1]. |
| Name | (R)-(-)-Littorin |
|---|---|
| Synonym | More Synonyms |
| Description | Littorine is a alkaloid that can be isolated from Anthocercis fittorea and Datura species[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H23NO3 |
|---|---|
| Molecular Weight | 289.36900 |
| Exact Mass | 289.16800 |
| PSA | 49.77000 |
| LogP | 1.69630 |
| InChIKey | FNRXUEYLFZLOEZ-VFSICIBPSA-N |
| SMILES | CN1C2CCC1CC(OC(=O)C(O)Cc1ccccc1)C2 |
| Littorin |
| Benzenepropanoic acid, a-hydroxy-,(3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, (aR)- |