2-Hydroxy-3,4,5,6-tetramethoxychalcone structure
|
Common Name | 2-Hydroxy-3,4,5,6-tetramethoxychalcone | ||
|---|---|---|---|---|
| CAS Number | 219298-74-5 | Molecular Weight | 344.358 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 532.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.8±23.6 °C | |
| Name | 2-Hydroxy-3,4,5,6-tetramethoxychalcone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.7±50.0 °C at 760 mmHg |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.358 |
| Flash Point | 189.8±23.6 °C |
| Exact Mass | 344.125977 |
| PSA | 74.22000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | WKHFCYYMOLJMDZ-ZHACJKMWSA-N |
| SMILES | COc1c(O)c(C=CC(=O)c2ccccc2)c(OC)c(OC)c1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (2E)-3-(2-Hydroxy-3,4,5,6-tetramethoxyphenyl)-1-phenyl-2-propen-1-one |
| 2-Propen-1-one, 3-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-1-phenyl-, (2E)- |