2-Pentafluorophenoxyethanol
Modify Date: 2025-09-30 12:02:14
2-Pentafluorophenoxyethanol structure
|
Common Name | 2-Pentafluorophenoxyethanol | ||
|---|---|---|---|---|
| CAS Number | 2192-55-4 | Molecular Weight | 228.11600 | |
| Density | 1.549 | Boiling Point | 185 °C | |
| Molecular Formula | C8H5F5O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >110 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(2,3,4,5,6-pentafluorophenoxy)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.549 |
|---|---|
| Boiling Point | 185 °C |
| Molecular Formula | C8H5F5O2 |
| Molecular Weight | 228.11600 |
| Flash Point | >110 °C |
| Exact Mass | 228.02100 |
| PSA | 29.46000 |
| LogP | 1.75320 |
| Vapour Pressure | 0.0297mmHg at 25°C |
| Index of Refraction | 1.44-1.442 |
| InChIKey | NPVVUYMVRISVGK-UHFFFAOYSA-N |
| SMILES | OCCOc1c(F)c(F)c(F)c(F)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2909499000 |
|
~%
2-Pentafluoroph... CAS#:2192-55-4 |
| Literature: Journal of Fluorine Chemistry, , vol. 29, p. 204 |
CAS#:1743-87-9
CAS#:664326-97-0
CAS#:6669-01-8| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
J. Polym. Sci. A1 9 , 553, (1971)
|
|
|
A new derivatization reagent 2-(pentafluorophenoxy) ethyl 2-(piperidino) ethanesulfonate for gas chromatography. Lin S-J, et al.
Anal. Chim. Acta 386(1) , 113-22, (1999)
|
| 2-(Pentafluorophenoxy)ethanol |
| 2-<Pentafluorphenoxy>-aethanol |
| Pentafluor-<2-hydroxy-aethoxy>-benzol |
| pentafluorophenoxyethanol |
| MFCD00191478 |