4-morpholin-4-yl-6-[(4-phenylpiperazin-1-yl)methyl]-1,3,5-triazin-2-amine structure
|
Common Name | 4-morpholin-4-yl-6-[(4-phenylpiperazin-1-yl)methyl]-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 21868-47-3 | Molecular Weight | 355.43700 | |
| Density | 1.286g/cm3 | Boiling Point | 609.9ºC at 760 mmHg | |
| Molecular Formula | C18H25N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.6ºC | |
| Name | 4-morpholin-4-yl-6-[(4-phenylpiperazin-1-yl)methyl]-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 609.9ºC at 760 mmHg |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.43700 |
| Flash Point | 322.6ºC |
| Exact Mass | 355.21200 |
| PSA | 84.37000 |
| LogP | 0.61060 |
| Vapour Pressure | 8.14E-15mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | XOJPBSDJHKZZML-UHFFFAOYSA-N |
| SMILES | Nc1nc(CN2CCN(c3ccccc3)CC2)nc(N2CCOCC2)n1 |
|
~%
4-morpholin-4-y... CAS#:21868-47-3 |
| Literature: Das,P.C. et al. Indian Journal of Chemistry, 1968 , vol. 6, p. 691 - 693 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| af48 |