Boc-L-beta-homoisoleucine structure
|
Common Name | Boc-L-beta-homoisoleucine | ||
|---|---|---|---|---|
| CAS Number | 218608-82-3 | Molecular Weight | 245.31500 | |
| Density | 1.046g/cm3 | Boiling Point | 374.3ºC at 760mmHg | |
| Molecular Formula | C12H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.2ºC | |
Use of Boc-L-beta-homoisoleucineBoc-β-HoIle-OH (compound III f) is an isoleucine derivative[1]. |
| Name | Boc-L-β-homoisoleucine |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-β-HoIle-OH (compound III f) is an isoleucine derivative[1]. |
|---|---|
| References |
| Density | 1.046g/cm3 |
|---|---|
| Boiling Point | 374.3ºC at 760mmHg |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.31500 |
| Flash Point | 180.2ºC |
| Exact Mass | 245.16300 |
| PSA | 75.63000 |
| LogP | 2.79140 |
| Vapour Pressure | 1.24E-06mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | CMRZYYUYDQRCEO-DTWKUNHWSA-N |
| SMILES | CCC(C)C(CC(=O)O)NC(=O)OC(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2924199090 |
|
~80%
Boc-L-beta-homo... CAS#:218608-82-3 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 44, # 12 p. 2611 - 2613 |
|
~%
Boc-L-beta-homo... CAS#:218608-82-3 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 43, # 10 p. 2152 - 2158 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-beta-homoisoleucine |
| Boc-Beta-HoIle-OH |
| Boc-β-Homoile-OH |
| BOC-B-HOMO-ILE-OH |
| Boc--HoIle-OH |
| MFCD01076254 |
| Boc-Beta-homo-Ile-OH |
| Boc-b-HoIle-OH |
| Boc-β-homo-Ile-OH |