BDP FL-PEG4-TCO
Modify Date: 2025-08-27 08:56:24
BDP FL-PEG4-TCO structure
|
Common Name | BDP FL-PEG4-TCO | ||
|---|---|---|---|---|
| CAS Number | 2183473-16-5 | Molecular Weight | 662.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H49BF2N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP FL-PEG4-TCOBDP FL-PEG4-TCO is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | BDP FL-PEG4-TCO |
|---|---|
| Synonym | More Synonyms |
| Description | BDP FL-PEG4-TCO is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C33H49BF2N4O7 |
|---|---|
| Molecular Weight | 662.57 |
| InChIKey | FISJDIFFUFNJNS-ONEGZZNKSA-N |
| SMILES | Cc1cc(C)n2c1C=C1C=CC(CCC(=O)NCCOCCOCCOCCOCCNC(=O)OC3CCC=CCCC3)=[N+]1[B-]2(F)F |
| MFCD31580132 |