BDP FL-PEG5-azide
Modify Date: 2025-08-27 07:10:47
BDP FL-PEG5-azide structure
|
Common Name | BDP FL-PEG5-azide | ||
|---|---|---|---|---|
| CAS Number | 2093197-91-0 | Molecular Weight | 580.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H39BF2N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP FL-PEG5-azideBDP FL-PEG5-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | BDP FL-PEG5-azide |
|---|
| Description | BDP FL-PEG5-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C26H39BF2N6O6 |
|---|---|
| Molecular Weight | 580.43 |
| InChIKey | VESMXQZJKDVRIC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n2c1C=C1C=CC(CCC(=O)NCCOCCOCCOCCOCCOCCN=[N+]=[N-])=[N+]1[B-]2(F)F |