2,4-Diamino-5-(3-amino-4-chloro-5-nitrophenyl)-6-ethylpyrimidine structure
|
Common Name | 2,4-Diamino-5-(3-amino-4-chloro-5-nitrophenyl)-6-ethylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 21813-35-4 | Molecular Weight | 293.70900 | |
| Density | 1.451g/cm3 | Boiling Point | 561.4ºC at 760mmHg | |
| Molecular Formula | C12H12ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.3ºC | |
| Name | 5-(4-chloro-3-nitrophenyl)-6-ethylpyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 561.4ºC at 760mmHg |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.70900 |
| Flash Point | 293.3ºC |
| Exact Mass | 293.06800 |
| PSA | 123.64000 |
| LogP | 4.11760 |
| Vapour Pressure | 1.24E-12mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | JUUBFXIMFOJFOF-UHFFFAOYSA-N |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2933599090 |
|---|
|
~96%
2,4-Diamino-5-(... CAS#:21813-35-4 |
| Literature: Bliss, Edward A.; Griffin, Roger J.; Stevens, Malcolm F. G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 2217 - 2228 |
|
~%
2,4-Diamino-5-(... CAS#:21813-35-4 |
| Literature: FMC Corporation Patent: US5521192 A1, 1996 ; |
|
~%
2,4-Diamino-5-(... CAS#:21813-35-4 |
| Literature: Griffin, Roger J.; Lowe, Philip R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 14 p. 1811 - 1820 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| m-nitropyrimethamine |
| 2,4-diamino-6-ethyl-5-(4-chloro-3-nitrophenyl)pyrimidine |
| Nitropyrimethamine |
| 5-(4-Chloro-3-nitro-phenyl)-6-ethyl-pyrimidine-2,4-diamine |
| 2,4-Diamino-5-(3-amino-4-chloro-5-nitrophenyl)-6-ethylpyrimidine |
| 2,4-diamino-5-(4-chloro-3-nitrophenyl)-6-ethylpyrimidine |