BDY TMR-X,SE structure
|
Common Name | BDY TMR-X,SE | ||
|---|---|---|---|---|
| CAS Number | 217190-15-3 | Molecular Weight | 608.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H35BF2N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDY TMR-X,SEBODIPY TMR-X SE is a potent fluorescent dye. BODIPY TMR-X SE can be used to label the primary amines (R-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. BODIPY TR-X binds to protein or antibody and has bright, orange fluorescent light. (λex=544 nm, λem=570 nm)[1][2]. |
| Name | BDY TMR-X, SE |
|---|---|
| Synonym | More Synonyms |
| Description | BODIPY TMR-X SE is a potent fluorescent dye. BODIPY TMR-X SE can be used to label the primary amines (R-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. BODIPY TR-X binds to protein or antibody and has bright, orange fluorescent light. (λex=544 nm, λem=570 nm)[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C31H35BF2N4O6 |
|---|---|
| Molecular Weight | 608.44 |
| Exact Mass | 608.261780 |
| InChIKey | GRDQURHVJJVDRY-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc3n2[B-](F)(F)[N+]2=C(C)C(CCC(=O)NCCCCCC(=O)ON4C(=O)CCC4=O)=C(C)C2=C3)cc1 |
| (T-4)-[N-[6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-5-[[5-(4-methoxyphenyl)-2H-pyrrol-2-ylidene-κN]methyl]-2,4-dimethyl-1H-pyrrole-3-propanamidato-κN1]difluoroboron |
| [N-{6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl}-3-(2-{[5-(4-methoxyphenyl)-1H-pyrrol-2-yl-κN]methylene}-3,5-dimethyl-2H-pyrrol-4-yl-κN)propanamidato](difluoro)boron |